4-Ethoxycinnamic acid
4-Ethoxycinnamic acid
CAS: 2373-79-7
Molecular Formula: C11H12O3
4-Ethoxycinnamic acid - Names and Identifiers
| Name | 4-Ethoxycinnamic acid |
| Synonyms | AURORA 6885 RARECHEM BK HW 0106 4-Ethoxycinnamic acid P-ETHOXYCINNAMIC ACID 4-Ethoxycinnanic acid 3-(4-ETHOXYPHENYL) PROPENOIC ACID (2E)-3-(4-ethoxyphenyl)prop-2-enoate (E)-3-(4-Ethoxyphenyl)-2-propenoic acid (2Z)-3-(4-ethoxyphenyl)prop-2-enoic acid (2E)-3-(4-ethoxyphenyl)prop-2-enoic acid 4-Ethoxycinnamic acid,predominantly trans |
| CAS | 2373-79-7 |
| InChI | InChI=1/C11H12O3/c1-2-14-10-6-3-9(4-7-10)5-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/p-1/b8-5+ |
4-Ethoxycinnamic acid - Physico-chemical Properties
| Molecular Formula | C11H12O3 |
| Molar Mass | 192.21 |
| Density | 1.161±0.06 g/cm3(Predicted) |
| Melting Point | 195-199°C(lit.) |
| Boling Point | 353.2±17.0 °C(Predicted) |
| Flash Point | 139.2°C |
| Vapor Presure | 1.34E-05mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| BRN | 3198068 |
| pKa | 4.61±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
4-Ethoxycinnamic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Hazard Class | IRRITANT |
4-Ethoxycinnamic acid - Introduction
4-Ethoxycinnamic acid(4-Ethoxycinnamic acid) is an organic compound with the chemical formula C11H12O3.
Nature:
-Appearance: White crystalline solid
-Melting Point: 181-184 ℃
-Solubility: Soluble in organic solvents such as ethanol, ether and chloroform, slightly soluble in water.
Use:
4-Ethoxycinnamic acid has certain applications in the pharmaceutical and cosmetic industries:
-Medicine: Used as an intermediate in the synthesis of various drugs, such as aspirin and antiplatelet drugs.
-Cosmetics: as a fragrance and antioxidant.
Method:
4-Ethoxycinnamic acid can be prepared by the following steps:
1. 4-hydroxycinnamic acid is reacted with alcohol (such as ethanol), and esterification reaction is carried out under acidic conditions to form 4-Ethoxycinnamic acid ester.
2. Hydrolyze the ester by an acid catalyst (such as sulfuric acid) to obtain 4-Ethoxycinnamic acid.
Safety Information:
4-Ethoxycinnamic acid is generally safe under normal use conditions, but the following safety operations are still recommended:
-Avoid contact with skin, eyes and mucous membranes. In case of contact, rinse immediately with plenty of water.
-Avoid inhaling dust and use personal protective equipment, such as respirators.
-Keep away from fire and high temperature when storing to prevent it from burning and exploding.
-Please use and handle the compound properly under professional guidance.
Nature:
-Appearance: White crystalline solid
-Melting Point: 181-184 ℃
-Solubility: Soluble in organic solvents such as ethanol, ether and chloroform, slightly soluble in water.
Use:
4-Ethoxycinnamic acid has certain applications in the pharmaceutical and cosmetic industries:
-Medicine: Used as an intermediate in the synthesis of various drugs, such as aspirin and antiplatelet drugs.
-Cosmetics: as a fragrance and antioxidant.
Method:
4-Ethoxycinnamic acid can be prepared by the following steps:
1. 4-hydroxycinnamic acid is reacted with alcohol (such as ethanol), and esterification reaction is carried out under acidic conditions to form 4-Ethoxycinnamic acid ester.
2. Hydrolyze the ester by an acid catalyst (such as sulfuric acid) to obtain 4-Ethoxycinnamic acid.
Safety Information:
4-Ethoxycinnamic acid is generally safe under normal use conditions, but the following safety operations are still recommended:
-Avoid contact with skin, eyes and mucous membranes. In case of contact, rinse immediately with plenty of water.
-Avoid inhaling dust and use personal protective equipment, such as respirators.
-Keep away from fire and high temperature when storing to prevent it from burning and exploding.
-Please use and handle the compound properly under professional guidance.
Last Update：2024-04-09 15:17:56
